| Identification | |
| Name: | DL-Histidine |
| Synonyms: | Histidine, DL- (8CI);1H-Imidazole-4-alanine;Histidine; |
| CAS: | 4998-57-6 |
| EINECS: | 225-660-9 |
| Molecular Formula: | C6H9N3O2 |
| Molecular Weight: | 155.15456 |
| InChI: | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.423 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.614 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystals |
| Specification: | white to slightly yellow crystalline powder Safety Statements:22-24/25-36/37-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
