| Identification | |
| Name: | 2,4-Imidazolidinedione,5-ethyl-3-methyl-5-phenyl- |
| Synonyms: | Hydantoin,5-ethyl-3-methyl-5-phenyl- (6CI,7CI,8CI);3-Ethylnirvanol;3-Methyl-5-ethyl-5-phenyl-2,4-imidazolidinedione;3-Methyl-5-ethyl-5-phenylhydantoin;5-Ethyl-3-methyl-5-phenyl-2,4(3H,5H)-imidazoledione;5-Ethyl-3-methyl-5-phenylhydantoin;5-Ethyl-3-methyl-5-phenylimidazolidin-2,4-dione;DL-Mephenytoin;Epiazin;Epilan;Fenantoin;Gerot-Epilan;Insulton;Mephenytoin;Mesantoin;Mesdontoin;Mesontoin;Methoin;Methylphenetoin;Metydan;NSC 34652;Phenantoin;Phenylethylmethylhydantoin;Sacerno;Sedantional;Sedantoin;Triantoin; |
| CAS: | 50-12-4 |
| EINECS: | 200-012-8 |
| Molecular Formula: | C12H14 N2 O2 |
| Molecular Weight: | 218.28 |
| InChI: | InChI=1/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 135-138 °C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.154g/cm3 |
| Solubility: | Practically insoluble in water. One gram dissolves in about 16 ml 95% ethanol. In water, 1,270 mg/L at 25 deg C (est) |
| Specification: |
3-Methyl-5-ethyl-5-phenylhydantoin (CAS NO.50-12-4) is also called (+-)-5-Ethyl-3-methyl-5-phenylhydantoin ; 2,4-Imidazolidinedione, 5-ethyl-3-methyl-5-phenyl- ; 2,4-Imidazolidinedione, 5-ethyl-3-methyl-5-phenyl-, (+-)- ; 3-Ethylnirvanol ; 3-Methyl-5,5-phenylethylhydantoin ; 5-24-08-00093 (Beilstein Handbook Reference) ; 5-Ethyl-3-methyl-5-phenyl-2,4(3H,5H)-imidazoledione ; 5-Ethyl-3-methyl-5-phenyl-2,4-imidazolidinedione ; 5-Ethyl-3-methyl-5-phenylhydantoin ; 5-Ethyl-3-methyl-5-phenylimidazolidin-2,4-dione ; 5-Ethyl-5-fenyl-3-methylhydantoin [Czech] ; Mefenitoina [INN-Spanish] ; Mephenytoine [INN-French] ; Mephenytoinum [INN-Latin] ; Phenylethylmethylhydantoin ; Sedantoinal ; Triantoin . 3-Methyl-5-ethyl-5-phenylhydantoin (CAS NO.50-12-4) is a white crystalline powder with odorless. It is soluble in chloroform, alcohol and ether, insoluble in water. |
| Biological Activity: | CYP2C19 substrate. Anticonvulsant. |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Color: | Crystals |
| Safety Data | |
 |
|
