| Identification | |
| Name: | 2,6-Dichlorobenzoic acid |
| Synonyms: | - |
| CAS: | 50-30-6 |
| EINECS: | 200-025-9 |
| Molecular Formula: | C7H4Cl2O2 |
| Molecular Weight: | 191.01 |
| InChI: | InChI=1/C7H4Cl2O2/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Boiling Point: | sublimes |
| Density: | 1.517 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Solubility: | < 0.1 g/100 ml at 20 C SOLVENT SOLUBILI |
| Appearance: | Yellowish Powder |
| Specification: | white to off-white crystalline powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| HS Code: | 29163900 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
