| Identification | |
| Name: | 2,4,6-Trichlorobenzoic acid |
| Synonyms: | 2,4,6-Trichlorobenzoicacid; |
| CAS: | 50-43-1 |
| Molecular Formula: | C7H3Cl3O2 |
| Molecular Weight: | 225.46 |
| InChI: | InChI=1/C7H3Cl3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2H,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.635 g/cm3 |
| Appearance: | beige to brown crystalline powder |
| Specification: |
2,4,6-Trichlorobenzoic acid (50-43-1) is also named as 4-09-00-01010 (Beilstein Handbook Reference) ; AI3-33271 ; BRN 1874127 ; Benzoic acid, 2,4,6-trichloro- . 2,4,6-Trichlorobenzoic acid (50-43-1) is beige to light brown crystalline powder. |
| Usage: | Reactant involved in:• ;Active-sodium-promoted reductive cleavage of halogenated benzoic acids1• ;Synthesis of aryl aminopyrazole benzamides for use as non-steroidal selective glucocorticoid receptor agonists2• ;Flame retardant monomer synthesis3• ;Synthesis of 3,4,7-trisubstituted coumarins for use as antifungals4• ;Solid-phase synthesis of saphenamycin analogs with antimicrobial activity5Cocatalyst for cis-dihydroxylation and epoxidation of alkenes6 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
