| Identification | |
| Name: | 2H-Pyran-5-carboxylicacid, 2-oxo- |
| Synonyms: | Coumalicacid (6CI);Glutaconic acid, 4-(hydroxymethylene)-, d-lactone (7CI);2-Oxo-1(2H)-pyran-5-carboxylic acid;2-Oxo-2H-pyran-5-carboxylic acid;2-Oxopyran-5-carboxylic acid;2-Pentenedioicacid, 4-(hydroxymethylene)-, d-lactone;NSC 22978;a-Pyrone-5-carboxylic acid; |
| CAS: | 500-05-0 |
| EINECS: | 207-899-0 |
| Molecular Formula: | C6H4O4 |
| Molecular Weight: | 140.09 |
| InChI: | InChI=1/C6H4O4/c7-5-2-1-4(3-10-5)6(8)9/h1-3H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.3°C |
| Density: | 1.542g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | Tan powder. |
| Specification: |
Coumalic acid (CAS NO.500-05-0) is also named as 2-Oxopyran-5-carboxylic acid ; 2-Pentenedioic acid, 4-(hydroxymethylene)-, delta-lactone ; Cumalic acid ; alpha-Pyrone-5-carboxylic acid ; 2-Oxopyran-5-carboxylic acid ; 2H-Pyran-5-carboxylic acid, 2-oxo- . Coumalic acid (CAS NO.500-05-0) is pale yellow to pale brown powder. It is an active ingredient in many sour or tart foods. It is found mostly in unripe fruits. |
| Flash Point: | 137.3°C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
 |
|
