| Identification | |
| Name: | Phosphorothioic acid,O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester |
| Synonyms: | Phosphorothioicacid, O-(3-chloro-4-nitrophenyl) O,O-di-Me ester (6CI); BAY 22190; Chlorothion;Chlorthion; Chlorthion methyl; Compound 22/190; Methylchlorothion; NSC 8927;O,O-Dimethyl O-(3-chloro-4-nitrophenyl) thiophosphate; O,O-DimethylO-(3-chloro-4-nitrophenyl)thionophosphate; O,O-DimethylO-3-chloro-4-nitrophenyl phosphorothioate; O-(3-Chloro-4-nitrophenyl)O,O-dimethyl phosphorothioate; OMS 217 |
| CAS: | 500-28-7 |
| EINECS: | 207-902-5 |
| Molecular Formula: | C8H9 Cl N O5 P S |
| Molecular Weight: | 297.66 |
| InChI: | InChI=1/C8H9ClNO5PS/c1-13-16(17,14-2)15-6-3-4-8(10(11)12)7(9)5-6/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN2811 6.1/PG 3 |
| Flash Point: | 175.5°C |
| Boiling Point: | 366.6°Cat760mmHg |
| Density: | 1.499g/cm3 |
| Refractive index: | 1.586 |
| Solubility: | Miscible in benzene, alcohol, ether MISCIBLE IN AROMATIC SOLVENTS SOL 1:25,000 IN WATER; READILY MISCIBLE IN TOLUENE & OIL In water @ 20 deg C, 40 mg/l; readily sol in common organic solvents with the exception of mineral oils In water, 40 mg/l at 20 deg C |
| Specification: | Safety Statements:13-60-61 13:Keep away from food, drink and animal feeding stuffs 60:This material and/or its container must be disposed of as hazardous waste 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 175.5°C |
| Storage Temperature: | 2-8°C |
| Color: | Pure compound is yellow crystals. ... Commercial product is a yellow oil. |
| Safety Data | |
 |
|
