| Identification | |
| Name: | Phenol, 3,5-dimethoxy- |
| Synonyms: | 1-Hydroxy-3,5-dimethoxybenzene;NSC 70955;Phloroglucinol dimethyl ether;Taxicatigenin; |
| CAS: | 500-99-2 |
| EINECS: | 207-917-7 |
| Molecular Formula: | C8H10O3 |
| Molecular Weight: | 154.16 |
| InChI: | InChI=1/C8H10O3/c1-10-7-3-6(9)4-8(5-7)11-2/h3-5,9H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.134 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.522 |
| Solubility: | Slightly soluble |
| Appearance: | slightly pink to yellow crystalline powder |
| Specification: | slightly pink to yellow crystalline powder Safety Statements:26-36-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29095090 |
| Storage Temperature: | Store in dark! |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
