Identification |
Name: | Benzenemethanol,4-hydroxy-3-methoxy-a-[(methylamino)methyl]- |
CAS: | 5001-33-2 |
Molecular Formula: | C10H15 N O3 |
Molecular Weight: | 197.231 |
InChI: | InChI=1/C10H15NO3/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2/h3-5,9,11-13H,6H2,1-2H3 |
Molecular Structure: |
![(C10H15NO3) Vanillylalcohol, a-[(methylamino)methyl]- (8CI); (?à)-Metanephrine;3-Methoxyadrenaline; 3-O-Methyle...](https://img1.guidechem.com/chem/e/dict/31/5001-33-2.jpg) |
Properties |
Density: | 1.172 g/cm3 |
Refractive index: | 1.556 |
Appearance: | Pale Yellow Solid |
Usage: | A metabolite of Epinephrine. A naturraly occurring derivative of Epinephrine, found in urine and in certain tissues. |
Safety Data |
|
 |