| Identification | |
| Name: | Benzenemethanol,4-hydroxy-3-methoxy-a-[(methylamino)methyl]- |
| CAS: | 5001-33-2 |
| Molecular Formula: | C10H15 N O3 |
| Molecular Weight: | 197.231 |
| InChI: | InChI=1/C10H15NO3/c1-11-6-9(13)7-3-4-8(12)10(5-7)14-2/h3-5,9,11-13H,6H2,1-2H3 |
| Molecular Structure: | ![(C10H15NO3) Vanillylalcohol, a-[(methylamino)methyl]- (8CI); (?à)-Metanephrine;3-Methoxyadrenaline; 3-O-Methyle...](https://img1.guidechem.com/chem/e/dict/31/5001-33-2.jpg) |
| Properties | |
| Density: | 1.172 g/cm3 |
| Refractive index: | 1.556 |
| Appearance: | Pale Yellow Solid |
| Usage: | A metabolite of Epinephrine. A naturraly occurring derivative of Epinephrine, found in urine and in certain tissues. |
| Safety Data | |
 |
|
