| Identification | |
| Name: | Carbonic acid,monolithium salt (9CI) |
| Synonyms: | Lithiumbicarbonate; Lithium bicarbonate (LiHCO3); Lithium carbonate (LiHCO3); Lithiumhydrogen carbonate; Lithium hydrogen carbonate (LiHCO3) |
| CAS: | 5006-97-3 |
| Molecular Formula: | CH2 O3 . Li |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 50 deg C (decomposes) |
| Solubility: | Insoluble in ethanol Solubility in water = 6.4, 7.6, 8.7, 10.0, 11.3, 12.7, 14.2, 16.5, and 19.1 g/100g solution at 0, 10, 20, 30, 40, 50, 60, 80, and 100 deg C, respectively; Solubility in water = 6.9, 8.2, 9.6, 11.1, 12.7, 14.5, 16.5, 19.7, and 23.6 g/100g H2O at 0, 10, 20, 30, 40, 50, 60, 80, and 100 deg C, respectively; Solubility is lower in the presence of sodium carbonate |
| Color: | White, monoclinic prisms White crystalline powder or granules |
| Safety Data | |
 |
|
