| Identification | |
| Name: | Piperazine,1-[(2,3,4-trimethoxyphenyl)methyl]- |
| Synonyms: | Piperazine,1-(2,3,4-trimethoxybenzyl)- (6CI,7CI,8CI);1-(2,3,4-Trimethoxybenzyl)piperazine; 1-[(2,3,4-Trimethoxyphenyl)methyl]piperazine;4-(2,3,4-Trimethoxybenzyl)piperazine; Preductal; Trimetazidine; Vasorel |
| CAS: | 5011-34-7 |
| EINECS: | 225-690-2 |
| Molecular Formula: | C14H22N2O3 |
| Molecular Weight: | 266.34 |
| InChI: | InChI=1/C14H22N2O3/c1-17-12-5-4-11(13(18-2)14(12)19-3)10-16-8-6-15-7-9-16/h4-5,15H,6-10H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 200 - 205 |
| Flash Point: | 174 ºC |
| Boiling Point: | 364 ºC at 760 mmHg |
| Density: | 1.092 g/cm3 |
| Solubility: | Very soluble |
| Appearance: | hite or off-white crystalline powder |
| Specification: |
Trimetazidine , with CAS number of 5011-34-7, can be called 1-[(2,3,4-Trimethoxyphenyl)methyl]piperazine ; 1-(2,3,4-Trimethoxybenzyl)piperazine ; Piperazine, 1-((2,3,4-trimethoxyphenyl)methyl)- ; Vastarel ; Kyurinett . |
| Flash Point: | 174 ºC |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | A drug for angina pectoris. |
| Safety Data | |
 |
|
