| Identification | |
| Name: | Furo[3,4-b]furan-2(3H)-one,tetrahydro-4-methoxy-, (3aS,6aR)- |
| Synonyms: | 4-methoxytetrahydrofuro[3,4-b]furan-2(3H)-one;furo[3,4-b]furan-2(3H)-one, tetrahydro-4-methoxy-;Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one; |
| CAS: | 501921-30-8 |
| Molecular Formula: | C7H10O4 |
| Molecular Weight: | 158.15 |
| InChI: | InChI=1/C7H10O4/c1-9-7-4-2-6(8)11-5(4)3-10-7/h4-5,7H,2-3H2,1H3 |
| Molecular Structure: | ![(C7H10O4) 4-methoxytetrahydrofuro[3,4-b]furan-2(3H)-one;furo[3,4-b]furan-2(3H)-one, tetrahydro-4-methoxy-;Tetr...](https://img1.guidechem.com/chem/e/dict/118/501921-30-8.jpg) |
| Properties | |
| Density: | 1.26 |
| Refractive index: | 1.482 |
| Specification: |
The (3aS,6aR)-Tetrahydro-4-methoxyfuro[3,4-b]furan-2(3H)-one, with the cas registry number 501921-30-8, has the systematic name of 4-methoxytetrahydrofuro[3,4-b]furan-2(3H)-one. And the molecular formula of the chemical is C7H10O4. The characteristics of this chemical are as followings: (1)# of Rule of 5 Violations: 0 ; (2)ACD/BCF (pH 5.5): 1; (3)ACD/BCF (pH 7.4): 1; (4)ACD/KOC (pH 5.5): 4.45; (5)ACD/KOC (pH 7.4): 4.45; (6)#H bond acceptors: 4; (7)#H bond donors: 0; (8)#Freely Rotating Bonds: 1; (9)Polar Surface Area: 44.76 Å2; (10)Index of Refraction: 1.482; (11)Molar Refractivity: 35.63 cm3; (12)Molar Volume: 124.9 cm3; (13)Polarizability: 14.12×10-24cm3; (14)Surface Tension: 38.5 dyne/cm; (15)Density: 1.26 g/cm3; (16)Flash Point: 140.6 °C; (17)Enthalpy of Vaporization: 55.25 kJ/mol; (18)Boiling Point: 311.6 °C at 760 mmHg; (19)Vapour Pressure: 0.000558 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
