| Identification | |
| Name: | 1H-Indole-3-propanamide,a-amino-, hydrochloride (1:1), (aS)- |
| Synonyms: | 1H-Indole-3-propanamide,a-amino-, monohydrochloride, (aS)- (9CI); Tryptophanamide,monohydrochloride, L- (8CI); L-Tryptophanamide hydrochloride |
| CAS: | 5022-65-1 |
| EINECS: | 225-708-9 |
| Molecular Formula: | C11H13 N3 O . Cl H |
| Molecular Weight: | 239.7 |
| InChI: | InChI=1/C11H13N3O.ClH/c12-9(11(13)15)5-7-6-14-10-4-2-1-3-8(7)10;/h1-4,6,9,14H,5,12H2,(H2,13,15);1H/t9-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 250 °C |
| Flash Point: | 255.4°C |
| Boiling Point: | 498.7°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 25 ° (C=1, H2O) |
| Specification: |
L-Tryptophanamide hydrochloride , its cas register number is 5022-65-1. It also can be called (S)-alpha-amino-1H-indole-3-propionamide monohydrochloride .It is a white solid. |
| Flash Point: | 255.4°C |
| Storage Temperature: | 2-8°C |
| Usage: |
L-Tryptophanamide hydrochloride (CAS NO.5022-65-1) can be used as a substrate for studying the action of aminopeptidase enzyme. |
| Safety Data | |
 |
|
