| Identification | |
| Name: | 2,5-Thiophenedicarboxylicacid, 2-methyl ester |
| Synonyms: | 2,5-Thiophenedicarboxylicacid, monomethyl ester (9CI); 5-(Methoxycarbonyl)thiophene-2-carboxylic acid;Methyl thiophene-2,5-dicarboxylate |
| CAS: | 50340-79-9 |
| Molecular Formula: | C7H6 O4 S |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H6O4S/c1-11-7(10)5-3-2-4(12-5)6(8)9/h2-3H,1H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.439g/cm3 |
| Refractive index: | 1.584 |
| Specification: |
A monoester derivative of of 5-(Methoxycarbonyl)thiophene-2-carboxylic acid (CAS NO.50340-79-9) , the carboxylic acid and the carboxylic acid ester groups are approximately coplanar with thiophene ring, making a dihedral angle of 3.1 (4) and 3.6 (4)°, respectively. In the crystal structure, molecules are connected by classical intermolecular O-HO hydrogen bonds, forming centrosymmetric dimers. |
| Safety Data | |
 |
|
