| Identification | |
| Name: | Hexanoic acid,2-ethyl-, tributylstannyl ester |
| Synonyms: | Stannane,tributyl[(2-ethyl-1-oxohexyl)oxy]- (9CI); Stannane,tributyl[(2-ethylhexanoyl)oxy]- (8CI); Tin, tributyl[(2-ethylhexanoyl)oxy]-(7CI); Tributyltin 2-ethylhexanoate (6CI); Hexanoic acid, 2-ethyl-,tributylstannyl deriv. (8CI); NSC 80691; Tributyltin 2-ethylcaproate |
| CAS: | 5035-67-6 |
| EINECS: | 225-726-7 |
| Molecular Formula: | C20H42 O2 Sn |
| Molecular Weight: | 433.31 |
| InChI: | InChI=1/C8H16O2.3C4H9.Sn/c1-3-5-6-7(4-2)8(9)10;3*1-3-4-2;/h7H,3-6H2,1-2H3,(H,9,10);3*1,3-4H2,2H3;/rC12H27Sn.C8H16O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-3-5-6-7(4-2)8(9)10/h4-12H2,1-3H3;7H,3-6H2,1-2H3,(H,9,10) |
| Molecular Structure: | ![(C20H42O2Sn) Stannane,tributyl[(2-ethyl-1-oxohexyl)oxy]- (9CI); Stannane,tributyl[(2-ethylhexanoyl)oxy]- (8CI); T...](https://img1.guidechem.com/chem/e/dict/130/5035-67-6.jpg) |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Tributyltin 2-ethylhexanoate , its cas register number is 5035-67-6. It also can be called Tributyltin 2-ethylhexanoate ; Tributyl((2-ethyl-1-oxohexyl)oxy)stannane ; Stannane, tributyl((2-ethylhexanoyl)oxy)- (8CI) ; and Stannane, ((2-ethylhexanoyl)oxy)tributyl . |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols | |
 |
|
