| Identification | |
| Name: | 1,3-Cyclohexanedione |
| Synonyms: | 1,3-Cyclohexandione;See also 1,3-Cyclohexanedione;1, 3-Benzenediol, dihydro-;cyclohexane-1,3-dione;1,3-Benzenediol, dihydro-;Resorcinol, dihydro-;1,3-Cyclohexanone;3-hydroxycyclohex-2-en-1-one;Dihydroresorcinol;Hydroresorcinol;1,3-cyclohexane dione; |
| CAS: | 504-02-9 |
| EINECS: | 207-980-0 |
| Molecular Formula: | C6H8O2 |
| Molecular Weight: | 112.13 |
| InChI: | InChI=1/C6H8O2/c7-5-2-1-3-6(8)4-5/h1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.1 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.473? |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Beige Crystalline Powder |
| Specification: |
?1,3-Cyclohexanedione , its CAS NO. is 504-02-9, the synonyms are 1,3-Benzenediol, dihydro- ; Resorcinol, dihydro- ;? 1,3-Cyclohexanone ; AI3-11062 ; Cyclohexane-1,3-dione ; Dihydroresorcinol . |
| HS Code: | 29142900 |
| Safety Data | |
 |
|
