| Identification | |
| Name: | Piperidine,2,6-dimethyl- |
| Synonyms: | 2,6-Lupetidine(6CI,7CI,8CI); 2,6-Dimethylpiperidine; Lupetidin; NSC 63890; NSC 7513;Naniopinum; Nanofin; Nanophin; Nanophine; Nanophyn |
| CAS: | 504-03-0 |
| EINECS: | 207-981-6 |
| Molecular Formula: | C7H15 N |
| Molecular Weight: | 113.23 |
| InChI: | InChI=1/C7H15N/c1-6-4-3-5-7(2)8-6/h6-8H,3-5H2,1-2H3/p+1/t6-,7-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3 |
| Flash Point: | 11 ºC |
| Density: | 0.84 |
| Refractive index: | 1.4384-1.4404 |
| Water Solubility: | MISCIBLE |
| Solubility: | Miscible with water |
| Appearance: | clear colorless to slightly yellow liquid |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| Flash Point: | 11 ºC |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
F: Flammable
C: Corrosive
|
 |
|
