| Identification | |
| Name: | 1,3-Dihydroxy-5-methylbenzene |
| Synonyms: | 3,5-Toluenediol; 3,5-Dihydroxytoluene |
| CAS: | 504-15-4 |
| EINECS: | 207-984-2 |
| Molecular Formula: | C7H8O2 |
| Molecular Weight: | 124.14 |
| InChI: | InChI=1/C7H8O2/c1-5-2-6(8)4-7(9)3-5/h2-4,8-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.21g/cm3 |
| Stability: | Stable under normal temperatures and pressures. Substance may discolor on exposure to light. |
| Refractive index: | 1.5403 |
| Solubility: | Slightly soluble |
| Appearance: | pink-grey to pink-brown cryst. powder or crystals |
| Specification: |
Orcinol , with CAS number of 504-15-4, can be called 1,3-Dihydroxy-5-methylbenzene ; 1,5-Dihydroxy-3-methylbenzene ; 3,5-Dihydroxytoluene ; 3-Hydroxy-5-methylphenol ; 5-Methyl-1,3-benzenediol ; 5-Methyl-1,3-dihydroxybenzene ; 5-Methylresorcinol ; Orcin . It is a pink-grey to pink-brown cryst. powder or crystal. Orcinol (CAS NO.504-15-4) can be used in organic synthesis, pharmaceutical intermediate and also can used as analytical reagent. |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29072900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from light and air. Store under an inert atmosphere. |
| Sensitive: | Air Sensitive |
| Usage: | Used as a a reagent for pentoses, lignin, beet sugar, saccharoses, arabinose, diastase. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
