| Identification | ||
| Name: | 4,6(1H,5H)-Pyrimidinedione,dihydro-2-thioxo- | |
| Synonyms: | Barbituricacid, 2-thio- (8CI);1,2,3,4,5,6-Hexahydro-4,6-dioxopyrimidine-2-thione;2-Mercapto-4,6-dihydroxypyrimidine;2-Mercaptobarbituric acid;2-Mercaptopyrimidine-4,6-diol;2-Thio-4,6-dioxypyrimidine;2-Thiobarbituricacid;2-Thiopyrimidine-4,6-diol;Austranal;Bathyran;Hexahydropyrimidine-4,6-dione-2-thione;NSC 4733;Thiobarbituric acid; | |
| CAS: | 504-17-6 | |
| EINECS: | 207-985-8 | |
| Molecular Formula: | C4H4N2O2S | |
| Molecular Weight: | 144.15 | |
| InChI: | InChI=1/C4H4N2O2S/c7-2-1-3(8)6-4(9)5-2/h1H2,(H2,5,6,7,8,9) | |
| Molecular Structure: |  |
|
| Properties | ||
| Density: | 1.69 g/cm3 | |
| Stability: | Stable. Incompatible with strong oxidizing agents. | |
| Refractive index: | 1.645 | |
| Water Solubility: | <6 g/L (20 ºC) | |
| Solubility: | <6 g/L (20 ºC) in water | |
| Appearance: | slightly yellow liquid | |
| Specification: | Off-White to Yellow Powder usageEng:Used to quantitate lipopolysaccharides, carrageenan, and sialic acids. Used to detect lipid hydroperoxides and lipid oxidation. CONTROLLED SUBSTANCE Safety Statements:22-24/25-37/39-26 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| HS Code: | 29335995 | |
| Storage Temperature: | Store in a tightly closed container. Keep under a nitrogen blanket. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Usage: | Used to quantitate lipopolysaccharides, carrageenan, and sialic acids. Used to detect lipid hydroperoxides and lipid oxidation. CONTROLLED SUBSTANC | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
