| Identification | |
| Name: | Propanoic acid,3-nitro- |
| Synonyms: | Propionicacid, 3-nitro- (6CI,7CI,8CI); 3-Nitropropanoic acid; 3-Nitropropionic acid;BNP; Bovinocidin; Hiptagenic acid; NSC 64266; b-Nitropropionic acid |
| CAS: | 504-88-1 |
| EINECS: | 208-003-0 |
| Molecular Formula: | C3H5 N O4 |
| Molecular Weight: | 119.0761 |
| InChI: | InChI=1S/C3H5NO4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 68-70 °C(lit.) |
| Flash Point: | 148.4°C |
| Boiling Point: | 303°Cat760mmHg |
| Density: | 1.393g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases, reducing agents. |
| Water Solubility: | substantial Stability Stable. Incompatible with strong oxidizing agents, bases, reducing agents. Toxicology Poison. Toxic if swallowed or inhaled. Toxicity data |
| Solubility: | substantial
|
| Appearance: | gold crystalline solid |
| Specification: | gold crystalline solid Safety Statements:26-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 148.4°C |
| Storage Temperature: | 2-8°C |
| Color: | Crystals from chloroform |
| Safety Data | |
 |
|
