| Identification | |
| Name: | 1-Hexadecene,7,11,15-trimethyl-3-methylene- |
| Synonyms: | 1,3-Butadiene,2-(4,8,12-trimethyltridecyl)- (6CI,7CI,8CI);2-(4,8,12-Trimethyltridecyl)buta-1,3-diene; 3-Methylene-7,11,15-trimethylhexadec-1-ene;Neophytadiene |
| CAS: | 504-96-1 |
| Molecular Formula: | C20H38 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C20H38/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17,19-20H,1,4,8-16H2,2-3,5-6H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 160.2°C |
| Boiling Point: | 344.5°Cat760mmHg |
| Density: | 0.796g/cm3 |
| Refractive index: | 1.449 |
| Specification: | Colorless Liquid usageEng:Enzyme inhibitor. This product contains up 15% hexanes and up to 5% of the analogous dimer by NMR |
| Flash Point: | 160.2°C |
| Usage: | Enzyme inhibitor. This product contains up 15% hexanes and up to 5% of the analogous dimer by NMR |
| Safety Data | |
 |
|
