| Identification | |
| Name: | Vinclozolin (3-(3,5-Dichlorophenyl)-5-ethenyl-5-methyl-2,4- oxazolidinedione) |
| CAS: | 50471-44-8 |
| EINECS: | 256-599-6 |
| Molecular Formula: | C12H9 Cl2 N O3 |
| Molecular Weight: | 286.12 |
| InChI: | InChI=1/C12H9Cl2NO3/c1-3-12(2)10(16)15(11(17)18-12)9-5-7(13)4-8(14)6-9/h3-6H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Density: | 1.496 g/cm3 |
| Refractive index: | 1.64 |
| Water Solubility: | v.s. in ethanol, acetone, ethyl acetate, cyclohexane, benzene, and xylene |
| Solubility: | v.s. in ethanol, acetone, ethyl acetate, cyclohexane, benzene, and xylene |
| Appearance: | Vinclozolin is a colorless crystal with a slight aromatic odor |
| Specification: | usageEng:Agricultural fungicide. Safety Statements:53-45-61-36-26-16 53:Avoid exposure - obtain special instruction before use 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 61:Avoid release to the environment. Refer to special instructions safety data sheet 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 16:Keep away from sources of ignition - No smoking |
| Storage Temperature: | APPROX 4°C |
| Color: | Colorless crystals. Crystalline solid. White solid (technical) |
| Usage: | Agricultural fungicide. |
| Safety Data | |
| Hazard Symbols | |
 |
|
