| Identification | |
| Name: | 2-Bromo-5-(trifluoromethyl)pyridine |
| Synonyms: | 5-(Trifluoromethyl)-2-bromopyridine;6-Bromo-3-trifluoromethylpyridine;2-Bromo-5-(trifluoromethyl)pyr; |
| CAS: | 50488-42-1 |
| Molecular Formula: | C6H3BrF3N |
| Molecular Weight: | 225.99 |
| InChI: | InChI=1/C13H8F2O2/c14-11-6-5-10(7-12(11)15)8-1-3-9(4-2-8)13(16)17/h1-7H,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 80.4 ºC |
| Boiling Point: | 209.3 ºC at 760 mmHg |
| Density: | 1.707 g/cm3 |
| Refractive index: | 1.572 |
| Appearance: | Light yellow needles |
| Specification: | Light yellow needles usageEng:Substrate used in a palladium-catalyzed α-arylation of a Refomatsky reagent.1 Safety Statements:26-36/37/39-22-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust 36:Wear suitable protective clothing |
| Flash Point: | 80.4 ºC |
| Storage Temperature: | Room temperature. |
| Usage: | Substrate used in a palladium-catalyzed α-arylation of a Refomatsky reagent.1 |
| Safety Data | |
| Hazard Symbols |
T:Toxic
Xn:Harmful
|
 |
|
