Identification |
Name: | 8,10,12-Heptadecatriene-4,6-diyne-1,14-diol,(8E,10E,12E,14R)- |
Synonyms: | 8,10,12-Heptadecatriene-4,6-diyne-1,14-diol,(E,E,E)-(-)-; Cicutoxin (6CI,7CI,8CI); (R)-(-)-Cicutoxin; NSC 606489 |
CAS: | 505-75-9 |
Molecular Formula: | C17H22 O2 |
Molecular Weight: | 258.39 |
InChI: | InChI=1/C17H22O2/c1-2-14-17(19)15-12-10-8-6-4-3-5-7-9-11-13-16-18/h4,6,8,10,12,15,17-19H,2,11,13-14,16H2,1H3/b6-4+,10-8+,15-12+ |
Molecular Structure: |
 |
Properties |
Melting Point: | 54 deg C /(-)-form/; 67 deg C /(+-)-form/ |
Flash Point: | 218.3°C |
Boiling Point: | 467.2°Cat760mmHg |
Density: | 1.025g/cm3 |
Refractive index: | 1.547 |
Solubility: | In water, 2.8 mg/L at 25 deg C (est) Soluble in alcohol, chloroform, ether, hot water, alkali hydroxides; practically insoluble in petroleum ether /(-)-form/ |
Specification: |
Cicutoxin (CAS NO.505-75-9) is a poisonous polyyne and alcohol found in various plants, most notably water hemlock (Cicuta species). It is structurally related to the oenanthotoxin of hemlock water dropwort.
Cicutoxin (CAS NO.505-75-9) causes death by disruption of the central nervous system. It is a potent, noncompetitive gamma-aminobutyric acid (GABA) receptor antagonist. In humans, cicutoxin rapidly produces symptoms of nausea, emesis and abdominal pain, typically within 60 minutes of ingestion. This can lead to tremors, seizures, and death.
|
Flash Point: | 218.3°C |
Color: | Prisms from ether + petroleum ether /(-)-form/; crystals from ether + petroleum ether /(+-)-form/ |
Safety Data |
|
 |