Identification |
Name: | 1H-Pyrrole-2,5-dione,1-[4-(phenylamino)-1-naphthalenyl]- |
Synonyms: | N-(4-Anilino-1-naphthyl)maleimide |
CAS: | 50539-45-2 |
EINECS: | 256-618-8 |
Molecular Formula: | C20H14 N2 O2 |
Molecular Weight: | 314.34 |
InChI: | InChI=1/C20H14N2O2/c23-19-12-13-20(24)22(19)18-11-10-17(15-8-4-5-9-16(15)18)21-14-6-2-1-3-7-14/h1-13,21H |
Molecular Structure: |
 |
Properties |
Melting Point: | 207 °C
|
Flash Point: | 269.3°C |
Boiling Point: | 521.6°C at 760 mmHg |
Density: | 1.364g/cm3 |
Refractive index: | 1.746 |
Specification: | red powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 269.3°C |
Safety Data |
|
 |