| Identification |
| Name: | 4-Piperidinamine,1-(phenylmethyl)- |
| Synonyms: | (1-Benzylpiperidin-4-yl)amine;1-(Phenylmethyl)-4-piperidinamine;1-Benzyl-4-aminopiperidine;1-Benzylpiperidine-4-amine;2-Amino-1-benzylpiperidine;4-Amino-1-(phenylmethyl)piperidine;4-Amino-N-benzylpiperidine;N-Benzyl-4-piperidinamine; |
| CAS: | 50541-93-0 |
| EINECS: | 256-620-9 |
| Molecular Formula: | C12H18N2 |
| Molecular Weight: | 190.29 |
| InChI: | InChI=1/C12H18N2/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-5,12-14H,6-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 190kgs |
| Density: | 0.933 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.541-1.543 |
| Water Solubility: | immiscible |
| Solubility: | Immiscible |
| Appearance: | clear to pale yellow liquid |
| HS Code: | 29333999 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
