| Identification | |
| Name: | Acetyl bromide |
| Synonyms: | Acetyl Bromide( Controlled Chemical) |
| CAS: | 506-96-7 |
| EINECS: | 208-061-7 |
| Molecular Formula: | C2H3BrO |
| Molecular Weight: | 122.95 |
| InChI: | InChI=1/C2H3BrO/c1-2(3)4/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1716 |
| Density: | 1.663 |
| Stability: | Decomposes violently on contact with moisture. Highly reactive. Hydrolyzes readily. Decomposition products are corrosive and toxic fumes of carbonyl bromide and bromine. |
| Refractive index: | 1.4485-1.4505 |
| Water Solubility: | REACTS |
| Solubility: | REACTS in water |
| Appearance: | colorless fuming liquid with a pungent odor |
| Specification: |
? Acetyl bromide (CAS NO.506-96-7), its Synonyms are Acetic acid, bromide ; Ethanoyl bromide . It is a colorless fuming liquid with a pungent odor. |
| Packinggroup: | II |
| HS Code: | 29159080 |
| Storage Temperature: | Protect from water. |
| Sensitive: | Moisture Sensitive |
| Color: | Colorless fuming liquid |
| Usage: | Organic synthesis, dye manufacture. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
