| Identification | |
| Name: | 2-Propanamine,N-hydroxy-, hydrochloride (9CI) |
| Synonyms: | Isopropylhydroxylaminehydrochloride;N-(2-Propyl)hydroxylamine hydrochloride;N-Hydroxy-2-propanaminehydrochloride;N-Isopropylhydroxylamine hydrochloride; |
| CAS: | 50632-53-6 |
| Molecular Formula: | C3H10ClNO |
| Molecular Weight: | 111.57 |
| InChI: | InChI=1S/C3H9NO/c1-3(2)4-5/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 68-72 °C |
| Appearance: | White to beige adhering crystalline powder |
| Specification: | white to beige adhering crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
