| Identification |
| Name: | Benzoic acid,4-methyl-, 4-pentylphenyl ester |
| Synonyms: | p-Amylphenylp-toluate;p-Pentylphenyl p-methylbenzoate; |
| CAS: | 50649-59-7 |
| EINECS: | 256-683-2 |
| Molecular Formula: | C19H22O2 |
| Molecular Weight: | 282.37678 |
| InChI: | InChI=1/C19H22O2/c1-3-4-5-6-16-9-13-18(14-10-16)21-19(20)17-11-7-15(2)8-12-17/h7-14H,3-6H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3082 |
| Flash Point: | 110 ºC |
| Density: | 1.04 g/cm3 |
| Refractive index: | 1.547 |
| Appearance: | UN 3082 9/PG 3 |
| Flash Point: | 110 ºC |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
N: Dangerous for the environment
|
| |
 |
