| Identification | |
| Name: | 1,1'-Biphenyl,4-bromo-4'-methyl- |
| Synonyms: | Biphenyl,4-bromo-4'-methyl- (6CI);4-Bromo-4'-methyl-1,1'-biphenyl;4-Bromo-4'-methylbiphenyl;4'-Bromo-4-methylbiphenyl; |
| CAS: | 50670-49-0 |
| Molecular Formula: | C13H11Br |
| Molecular Weight: | 247.13 |
| InChI: | InChI=1/C13H11Br/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.32 g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
The 4-Bromo-4'-methylbiphenyl with the CAS number 50670-49-0 is also called 1,1'-Biphenyl,4-bromo-4'-methyl-. Its molecular formula is C13H11Br. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the 4-Bromo-4'-methylbiphenyl are: (1)ACD/LogP: 5.34; (2)# of Rule of 5 Violations: 1; (3)ACD/LogD (pH 5.5): 5.34; (4)ACD/LogD (pH 7.4): 5.34; (5)ACD/BCF (pH 5.5): 6735.54; (6)ACD/BCF (pH 7.4): 6735.54; (7)ACD/KOC (pH 5.5): 19139.94; (8)ACD/KOC (pH 7.4): 19139.94; (9)#H bond acceptors: 0; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 0 Å2; (13)Index of Refraction: 1.592; (14)Molar Refractivity: 63.35 cm3; (15)Molar Volume: 187.1 cm3; (16)Polarizability: 25.11×10-24cm3; (17)Surface Tension: 39.3 dyne/cm; (18)Enthalpy of Vaporization: 54.23 kJ/mol; (19)Vapour Pressure: 0.000513 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
