| Identification | |
| Name: | Benzonitrile,5-amino-2-methyl- |
| Synonyms: | 3-Amino-6-methylbenzonitrile;3-Cyano-4-methylaniline;5-Amino-2-methylbenzonitrile; |
| CAS: | 50670-64-9 |
| Molecular Formula: | C8H8N2 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C8H8N2/c1-6-2-3-8(10)4-7(6)5-9/h2-4H,10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 88-91 °C(lit.) |
| Flash Point: | 135.4°C |
| Boiling Point: | 300.3°C at 760 mmHg |
| Density: | 1.1g/cm3 |
| Refractive index: | 1.575 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 135.4°C |
| Safety Data | |
 |
|
