| Identification | |
| Name: | Acetyl iodide |
| Synonyms: | Acetyliodide;95% |
| CAS: | 507-02-8 |
| EINECS: | 208-062-2 |
| Molecular Formula: | C2H3 I O |
| Molecular Weight: | 169.95 |
| InChI: | InChI=1/C2H3IO/c1-2(3)4/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1898 |
| Flash Point: | 17.6°C |
| Boiling Point: | 105.5°Cat760mmHg |
| Density: | 2.193g/cm3 |
| Refractive index: | 1.539 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Flash Point: | 17.6°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
