| Identification | |
| Name: | 2,5-Cyclohexadien-1-one,4-(acetylimino)- |
| Synonyms: | Acetamide,N-(4-oxo-2,5-cyclohexadien-1-ylidene)- (9CI);Acetimidoquinone;N-Acetyl-1,4-benzoquinonimine;N-Acetyl-p-benzoquinonimine;NAPQI; |
| CAS: | 50700-49-7 |
| Molecular Formula: | C8H7NO2 |
| Molecular Weight: | 149.1467 |
| InChI: | InChI=1/C8H7NO2/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 74-75 |
| Flash Point: | 101.6 ºC |
| Boiling Point: | 255.6 ºC at 760 mmHg |
| Density: | 1.13 g/cm3 |
| Stability: | Temperature, Moisture, Light, and Oxygen Sensitive |
| Refractive index: | 1.544 |
| Appearance: | Yellow Crystalline Solid |
| Specification: | Yellow Crystalline Solid usageEng:A toxic metabolite of Acetaminophen, which reacts with serum proteins |
| Flash Point: | 101.6 ºC |
| Storage Temperature: | −20°C |
| Usage: | A toxic metabolite of Acetaminophen, which reacts with serum proteins |
| Safety Data | |
 |
|
