| Identification | |
| Name: | TPCA-1 |
| Synonyms: | TPCA-1 |
| CAS: | 507475-17-4 |
| Molecular Formula: | C12H10FN3O2S |
| Molecular Weight: | 279.294 |
| InChI: | InChI=1/C12H10FN3O2S/c13-7-3-1-6(2-4-7)9-5-8(10(14)17)11(19-9)16-12(15)18/h1-5H,(H2,14,17)(H3,15,16,18) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 221.462°C |
| Boiling Point: | 442.576°C at 760 mmHg |
| Density: | 1.491g/cm3 |
| Refractive index: | 1.686 |
| Specification: | Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Biological Activity: | Potent, selective inhibitor of I κ B kinase-2 (IKK-2) (IC 50 = 17.9 nM) that displays > 22-fold selectivity over IKK-1 and > 550-fold selectivity over other kinases and enzymes. Inhibits production of pro-inflammatory cytokines in vitro and in vivo and inhibits NF- κ B nuclear localisation. Reduces the severity and onset of collagen-induced arthritis; anti-inflammatory. |
| Flash Point: | 221.462°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
