| Identification | |
| Name: | 2-Pyrrolidinone,1,5-dimethyl- |
| CAS: | 5075-92-3 |
| EINECS: | 225-783-8 |
| Molecular Formula: | C6H11 N O |
| Molecular Weight: | 113.16 |
| InChI: | InChI=1/C6H11NO/c1-5-3-4-6(8)7(5)2/h5H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 89.4°C |
| Boiling Point: | 216.9°Cat760mmHg |
| Density: | 0.973g/cm3 |
| Refractive index: | n20/D 1.465(lit.) |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 89.4°C |
| Safety Data | |
 |
|
