| Identification | |
| Name: | p-propenylanisole |
| Synonyms: | Benzene, 1-methoxy-4-(propen-1-yl)-;1-(4-Methoxyphenyl)-1(3)-propene;Benzene, 1-methoxy-4-(propenyl)- |
| CAS: | 50770-19-9 |
| EINECS: | 256-753-2 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.204 |
| InChI: | InChI=1/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | MAX ABSORPTION (ISOOCTANE): 258 NM (LOG E= 4.25); MELTING POINT 21.35 DEG C; BP: 234.5 DEG @ 763 MM HG /TRANS-ISOMER/ CRYSTALLINE MASS AT 20-21 DEG C, LIQUID ABOVE 23 DEG C /TRANS-ISOMER/ INDEX OF REFRACTION: 1.55455 @ 20 DEG C/D; MAX ABSORPTION (ETHANOL): 253 NM (E= 18,500); MELTING POINT -22.5 DEG C; BOILING POINT 79-79.5 DEG C @ 23 MM HG /CIS-ISOMER/ DISTILLATION RANGE: 234-237 DEG C Liquid Molar Volume = 0.1507 cu m/kmol; Heat of Fusion @ Melting Point = 1.60E+7 J/kmol |
| Flash Point: | 88.4°C |
| Boiling Point: | 234 deg C |
| Density: | 0.959g/cm3 |
| Flash Point: | 88.4°C |
| Safety Data | |
 |
|
