| Identification | |
| Name: | Thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione |
| Synonyms: | [1,3]thiazolo[5,4-d]pyrimidine-5,7(4h,6h)-dione;5082-82-6;NSC160798;AC1L6KU0;AC1Q6M56;KST-1A5185;AR-1A8678;thiazolo[4,5-e]pyrimidine-5,7-diol;AKOS006371013;NSC-160798;[1,3]thiazolo[5,4-d]pyrimidine-5,7-diol;Thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione;4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione;S03-0282 |
| CAS: | 5082-82-6 |
| Molecular Formula: | C5H3N3O2S |
| Molecular Weight: | 169.16 |
| InChI: | InChI=1/C5H3N3O2S/c9-3-2-4(11-1-6-2)8-5(10)7-3/h1H,(H2,7,8,9,10) |
| Molecular Structure: | ![(C5H3N3O2S) [1,3]thiazolo[5,4-d]pyrimidine-5,7(4h,6h)-dione;5082-82-6;NSC160798;AC1L6KU0;AC1Q6M56;KST-1A5185;AR-...](https://img.guidechem.com/structureimg/5082-82-6.gif) |
| Properties | |
| Density: | 1.626 |
| Refractive index: | 1.635 |
| Specification: |
The Thiazolo[5,4-d]pyrimidine-5,7(4H,6H)-dione is an organic compound with the formula C5H3N3O2S. The IUPAC name of this chemical is 4H-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione. With the CAS registry number 5082-82-6, it is also named as [1,3]thiazolo[5,4-d]pyrimidine-5,7-diol. Physical properties about this chemical are: (1)ACD/LogP: -1.23; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 5; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 0 ; (6)Index of Refraction: 1.635; (7)Molar Volume: 104 cm3; (8)Surface Tension: 68.9 dyne/cm; (9)Density: 1.626 g/cm3. Additionally, you could obtain the molecular structure by converting the following datas: |
| Safety Data | |
 |
|
