| Identification | |
| Name: | Benzene,2-(bromomethyl)-1,4-dimethyl- |
| Synonyms: | 2,5-DIMETHYLBENZYL BROMIDE;2,5-Dimethylbenzylbromid |
| CAS: | 50837-53-1 |
| Molecular Formula: | C9H11 Br |
| Molecular Weight: | 199.09 |
| InChI: | InChI=1/C9H11Br/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 100.583°C |
| Boiling Point: | 233.837°C at 760 mmHg |
| Density: | 1.314g/cm3 |
| Refractive index: | 1.554 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 100.583°C |
| Safety Data | |
 |
|
