Identification |
Name: | Benzene,2-(bromomethyl)-1,4-dimethyl- |
Synonyms: | 2,5-DIMETHYLBENZYL BROMIDE;2,5-Dimethylbenzylbromid |
CAS: | 50837-53-1 |
Molecular Formula: | C9H11 Br |
Molecular Weight: | 199.09 |
InChI: | InChI=1/C9H11Br/c1-7-3-4-8(2)9(5-7)6-10/h3-5H,6H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 3265 |
Flash Point: | 100.583°C |
Boiling Point: | 233.837°C at 760 mmHg |
Density: | 1.314g/cm3 |
Refractive index: | 1.554 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 100.583°C |
Safety Data |
|
|