Identification |
Name: | 3,5-Dibenzyloxyphenyloxirane |
Synonyms: | [3,5-Bis(benzyloxy)phenyl]oxirane;[3,5-Bis(phenylmethoxy)phenyl]oxirane;3,5-Dibenzyloxyphenyloxirane |
CAS: | 50841-47-9 |
Molecular Formula: | C22H20O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C22H20O3/c1-3-7-17(8-4-1)14-23-20-11-19(22-16-25-22)12-21(13-20)24-15-18-9-5-2-6-10-18/h1-13,22H,14-16H2 |
Molecular Structure: |
![(C22H20O3) [3,5-Bis(benzyloxy)phenyl]oxirane;[3,5-Bis(phenylmethoxy)phenyl]oxirane;3,5-Dibenzyloxyphenyloxirane](https://img.guidechem.com/structure/50841-47-9.gif) |
Properties |
Flash Point: | 172.3°C |
Boiling Point: | 501.5°C at 760 mmHg |
Density: | 1.196g/cm3 |
Refractive index: | 1.619 |
Specification: | Yellow Syrup usageEng:An intermediate for the preparation of Terbutaline |
Flash Point: | 172.3°C |
Usage: | An intermediate for the preparation of Terbutaline |
Safety Data |
|
 |