| Identification | |
| Name: | Ibudilast |
| Synonyms: | Pyrazolo[1,5-a]pyridine,1-propanone deriv.;1-(2-Isopropylpyrazolo[1,5-a]pyridin-3-yl)-2-methylpropan-1-one;2-Isopropyl-3-isobutyrylpyrazolo[1,5-a]pyridine;AV 411;KC 404;Ketas;1-Propanone,2-methyl-1-[2-(1-methylethyl)pyrazolo[1,5-a]pyridin-3-yl]-; |
| CAS: | 50847-11-5 |
| Molecular Formula: | C14H18N2O |
| Molecular Weight: | 230.30552 |
| InChI: | InChI=1S/C14H18N2O/c1-9(2)13-12(14(17)10(3)4)11-7-5-6-8-16(11)15-13/h5-10H,1-4H3 |
| Molecular Structure: | ![(C14H18N2O) Pyrazolo[1,5-a]pyridine,1-propanone deriv.;1-(2-Isopropylpyrazolo[1,5-a]pyridin-3-yl)-2-methylpropan...](https://img.guidechem.com/casimg/50847-11-5.gif) |
| Properties | |
| Density: | 1.09 |
| Refractive index: | 1.57 |
| Water Solubility: | DMSO: 28 mg/mL, soluble |
| Solubility: | DMSO: 28 mg/mL, soluble |
| Appearance: | white solid |
| Specification: | White Solid usageEng:A leukotriene D4 antagonist. Used as an antiallergic, antiasthmatic, and vasodilator (cerebral) Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Phosphodiesterase inhibitor (IC 50 values are 53, 35, 48, 12 and 10 mM for PDE Ia, II, III, IV and V respectively). Inhibits platelet aggregation and is an orally-active cerebral vasodilator, bronchodilator and antiallergic agent. |
| Color: | white |
| Usage: | A leukotriene D4 antagonist. Used as an antiallergic, antiasthmatic, and vasodilator (cerebral) |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
