| Identification |
| Name: | Benzenamine,5-methoxy-2-methyl- |
| Synonyms: | 2-Methyl-5-methoxyaniline;3-Amino-4-methylanisole;3-Methoxy-6-methylaniline;5-Methoxy-2-methylaniline;NSC 229308; |
| CAS: | 50868-72-9 |
| EINECS: | 256-816-4 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,9H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Boiling Point: | 252.2 ºC at 760 mmHg |
| Density: | 1.039 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.549 |
| Solubility: | 10 g/L (25 C) |
| Appearance: | White to gray to tan crystalline powder |
| Storage Temperature: | Keep container tightly closed. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
