| Identification |
| Name: | Methyl acrylate, vinyl acetate, monomethyl maleate polymer |
| Synonyms: | AC1O553J;2-Butenedioic acid (2Z)-, monomethyl ester, polymer with ethenyl acetate and methyl 2-propenoate;Methyl acrylate, vinyl acetate, monomethyl maleate polymer;ethenyl acetate; (Z)-4-methoxy-4-oxobut-2-enoic acid; methyl prop-2-enoate;2-Butenedioic acid (2Z)-, 1-methyl ester, polymer with ethenyl acetate and methyl 2-propenoate;50886-03-8 |
| CAS: | 50886-03-8 |
| Molecular Formula: | C13H18O8 |
| Molecular Weight: | 302.27722 |
| InChI: | InChI=1S/C5H6O4.2C4H6O2/c1-9-5(8)3-2-4(6)7;1-3-4(5)6-2;1-3-6-4(2)5/h2-3H,1H3,(H,6,7);2*3H,1H2,2H3/b3-2-;; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 108.9°C |
| Boiling Point: | 250°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 108.9°C |
| Safety Data |
| |
 |
