| Identification | |
| Name: | 11H-Dibenzo[b,e][1,4]diazepin-11-one,8-chloro-5,10-dihydro- |
| Synonyms: | 8-Chloro-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one; |
| CAS: | 50892-62-1 |
| Molecular Formula: | C13H9ClN2O |
| Molecular Weight: | 244.68 |
| InChI: | InChI=1/C13H9ClN2O/c14-8-5-6-11-12(7-8)16-13(17)9-3-1-2-4-10(9)15-11/h1-7,15H,(H,16,17) |
| Molecular Structure: | ![(C13H9ClN2O) 8-Chloro-5H-dibenzo[b,e][1,4]diazepin-11(10H)-one;](https://img1.guidechem.com/chem/e/dict/22/50892-62-1.jpg) |
| Properties | |
| Flash Point: | 156°C |
| Boiling Point: | 334.4°Cat760mmHg |
| Density: | 1.327g/cm3 |
| Stability: | Store in Freezer |
| Refractive index: | 1.629 |
| Appearance: | white solid |
| Specification: | White Solid usageEng:A useful intermediate for the preparation of pharmaceutical actives and fine chemicals |
| Flash Point: | 156°C |
| Storage Temperature: | -20?C Freezer |
| Usage: | A useful intermediate for the preparation of pharmaceutical actives and fine chemicals |
| Safety Data | |
 |
|
