| Identification | |
| Name: | cis-2-Amino-5-methyl-4-phenyl-1-pyrroline |
| Synonyms: | 1-Pyrroline, 2-amino-5-methyl-4-phenyl-, (Z)-;cis-2-Amino-5-methyl-4-phenyl-1-pyrroline;AC1MI7C3;50901-84-3;LS-139040;(2R,3S)-2-methyl-3-phenyl-3,4-dihydro-2H-pyrrol-5-amine |
| CAS: | 50901-84-3 |
| Molecular Formula: | C11H14N2 |
| Molecular Weight: | 174.2423 |
| InChI: | InChI=1/C11H14N2/c1-8-10(7-11(12)13-8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H2,12,13)/t8-,10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 142.6°C |
| Boiling Point: | 312.1°C at 760 mmHg |
| Density: | 1.13g/cm3 |
| Refractive index: | 1.607 |
| Specification: |
The extinguishing agent of cis-2-Amino-5-methyl-4-phenyl-1-pyrroline (CAS NO.50901-84-3) are foam, sand, carbon dioxide, water mist and dry powder . |
| Flash Point: | 142.6°C |
| Safety Data | |
 |
|
