| Identification | |
| Name: | 1H-Imidazole-4-carboxamide,5-hydroxy-1-b-D-ribofuranosyl- |
| Synonyms: | 5-Hydroxy-1-beta-D-ribofuranosyl-1H-imidazole-4-carboxamide; |
| CAS: | 50924-49-7 |
| Molecular Formula: | C9H13N3O6 |
| Molecular Weight: | 259.25 |
| InChI: | InChI=1/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >2000C |
| Density: | 2.06 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.794 |
| Solubility: | 1.4 g/L (25 C) |
| Appearance: | white to off-white crystalline powder |
| Specification: |
50524-49-7 |
| Storage Temperature: | 2-8°C |
| Usage: | Nucleoside antibiotic with cytotoxic and immunosuppressive activity |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
