| Identification | |
| Name: | Pyridine,4-bromo-2,6-dimethyl- |
| Synonyms: | 2,6-Lutidine,4-bromo- (6CI,7CI,8CI);4-Bromo-2,6-lutidine; |
| CAS: | 5093-70-9 |
| Molecular Formula: | C7H8BrN |
| Molecular Weight: | 186.0491 |
| InChI: | InChI=1/C7H8BrN/c1-5-3-7(8)4-6(2)9-5/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.415 g/cm43 |
| Refractive index: | 1.547 |
| Specification: |
The IUPAC name of this chemical is 4-bromo-2,6-dimethylpyridine. With the CAS registry number 5093-70-9, it is also named as pyridine, 4-bromo-2,6-dimethyl-. The product's categories are pharmacetical; heterocyclic compounds; building blocks; pyridine. This chemical must be sealed in the container and avoided direct sunshine. The other characteristics of this product can be summarized as: (1)ACD/LogP: 2.32; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 19; (6)ACD/BCF (pH 7.4): 34; (7)ACD/KOC (pH 5.5): 242; (8)ACD/KOC (pH 7.4): 431; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.547; (13)Molar Refractivity: 41.684 cm3; (14)Molar Volume: 131.392 cm3; (15)Polarizability: 16.525×10-24 cm3; (16)Surface Tension: 38.46 dyne/cm; (17)Enthalpy of Vaporization: 42.543 kJ/mol; (18)Vapour Pressure: 0.327 mmHg at 25°C; (19)Exact Mass: 184.984012; (20)MonoIsotopic Mass: 184.984012; (21)Topological Polar Surface Area: 12.9; (22)Heavy Atom Count: 9; (23)Complexity: 84.9. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
