| Identification | |
| Name: | Procaine hydrochloride |
| Synonyms: | 2-(Diethylamino)ethyl 4-aminobenzoate; Procaine Hcl; ATOXICAINE |
| CAS: | 51-05-8 |
| EINECS: | 200-077-2 |
| Molecular Formula: | C13H20N2O2?HCl |
| Molecular Weight: | 272.77 |
| InChI: | InChI=1/C13H20N2O2.ClH/c1-3-15(4-2)9-10-17-13(16)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder Safety Statements:36/37/39-45-37/39-26 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
