| Identification |
| Name: | Benzoicacid, 3,4-dichloro- |
| Synonyms: | 3,4-Dichlorobenzoicacid;NSC 17583;NSC 34414; |
| CAS: | 51-44-5 |
| EINECS: | 200-099-2 |
| Molecular Formula: | C7H4Cl2O2 |
| Molecular Weight: | 191.01 |
| InChI: | InChI=1/C7H4Cl2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,(H,10,11) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.517 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | White to light yellow crystal powder |
| HS Code: | 29163900 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
