| Identification | |
| Name: | Benzeneethanamine, N,a-dimethyl-, hydrochloride (1:1),(aS)- |
| Synonyms: | Benzeneethanamine,N,a-dimethyl-, hydrochloride, (S)-;Benzeneethanamine, N,a-dimethyl-, hydrochloride, (aS)- (9CI); Phenethylamine, N,a-dimethyl-, hydrochloride, (S)-(+)- (8CI);(+)-2-Methylamino-2-phenylpropane hydrochloride; (+)-L-Methamphetaminehydrochloride; (+)-Methamphetamine chloride; (+)-Methamphetamine hydrochloride;(+)-Methylamphetamine hydrochloride; (+)-N,a-Dimethylphenethylamine hydrochloride;(+)-N-Methylamphetamine hydrochloride; Adipex; Amphedroxyn; D-Methamphetaminehydrochloride; Deofed; Desfedrin; Desoxo 5; Desoxyfed; Desoxyn; Desoxyne;Destim; Desyphed; Dexoval; Dextim; Doxephrin; Doxyfed; Drinalfa; Efroxine;Eufodrinal; Gerobit; Gerovit; Hiropon; Isophen; Madrine; Metamphetaminehydrochloride; Meth; Methampex; Methamphetamine hydrochloride;Methamphetaminium chloride; Methedrine; Methedrine hydrochloride;Methylamphetamine hydrochloride; Methylisomin; Methylisomyn;N-Methylamphetamine hydrochloride; NSC 169505; Norodin hydrochloride; Pervitin;Philopon; S-(+)-Methamphetamine hydrochloride; Semoxydrine; Soxysympamine;Speed; Syndrox; Tonedron; d-Deoxyephedrine hydrochloride; d-Desoxyephedrinehydrochloride; d-Methamphetamine hydrochloride; d-Methamphetaminehydrochloride; d-Methylamphetamine hydrochloride |
| CAS: | 51-57-0 |
| EINECS: | 200-106-9 |
| Molecular Formula: | C10H15 N . Cl H |
| Molecular Weight: | 185.72 |
| InChI: | InChI=1/C10H15N.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;/h3-7,9,11H,8H2,1-2H3;1H/t9-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Melting Point: | 166-168?C |
| Density: | g/cm3 |
| Solubility: | 0.5 g/ml of water SOL IN ETHANOL, DIETHYL ETHER Miscible with chloroform |
| Specification: | Off-White Solid usageEng:A CNS stimulant. Anorexic. In attention deficit disorder with hyperactivity. Controlled substance (stimulant). Safety Statements:45 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | Clear, colorless liquid |
| Usage: | A CNS stimulant. Anorexic. In attention deficit disorder with hyperactivity. Controlled substance (stimulant). |
| Safety Data | |
 |
|
