| Identification |
| Name: | Phenol, 4-amino-,hydrochloride (1:1) |
| Synonyms: | Phenol,4-amino-, hydrochloride (9CI);Phenol, p-amino-, hydrochloride (8CI);4-Hydroxyanilinium chloride;C.I. 76551;C.I.Oxidation Base 6A;Durafur Brown R;Fouramine CP;Fourrine 83;Fourrine P;Furro P;Futramine P;Pelagol CP;Pelagol Grey CP;Peltol P;p-Aminophenolhydrochloride;p-Hydroxyaniline hydrochloride; |
| CAS: | 51-78-5 |
| EINECS: | 200-122-6 |
| Molecular Formula: | C6H7NO.HCl |
| Molecular Weight: | 145.59 |
| InChI: | InChI=1/C6H7NO.ClH/c7-5-1-3-6(8)4-2-5;/h1-4,8H,7H2;1H |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 124.3°C |
| Boiling Point: | 282°Cat760mmHg |
| Density: | 1.21g/cm3 |
| Stability: | Stable, but hygroscopic, air and light sensitive. Incompatible with strong oxidizing agents. |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white to beige crystalline powder |
| Packinggroup: | I; II; III |
| HS Code: | 29222900 |
| Flash Point: | 124.3°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. Do not expose to air. Store protected from light. Store under an inert atmosphere. |
| Color: | gray |
| Usage: | Photographic developer, intermediate in manufacture of sulfur and azo dyes, in dyeing furs and feathers p-aminophenol. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
