| Identification | |
| Name: | [1,1'-Biphenyl]-4-aceticacid, 2-fluoro-a-methyl- |
| Synonyms: | 4-Biphenylaceticacid, 2-fluoro-a-methyl- (8CI);Hydratropic acid, 3-fluoro-4-phenyl- (7CI);2-(2-Fluoro-4-biphenylyl)propionic acid;2-Fluoro-a-methyl-4-diphenylacetic acid;3-Fluoro-4-phenylhydratropicacid;Adfeed;Ansaid;Antadys;BTS 18322;Cebutid;FP 70;FP-A;Flugalin;Racemic flurbiprofen;Stayban;U 27182;Zepolas;dl-2-(2-Fluoro-4-biphenylyl)propionic acid;rac-Flurbiprofen; |
| CAS: | 5104-49-4 |
| EINECS: | 225-827-6 |
| Molecular Formula: | C15H13FO2 |
| Molecular Weight: | 244.260923 |
| InChI: | InChI=1S/C15H13FO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h2-10H,1H3,(H,17,18) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 2 |
| Flash Point: | 181 |
| Boiling Point: | 376 |
| Density: | 1.279 g/cm3 (25 C) |
| Stability: | Stable at normal temperatures and pressures. |
| Water Solubility: | Slight soluble |
| Solubility: | ll mg/L (25 C) |
| Appearance: | white to off-white crystalline solid |
| Specification: | White to Off-White Crystalline Solid usageEng:An anti-inflammatory used as an analgesic. Safety Statements:36/37/39-45 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | 181 |
| Storage Temperature: | Keep tightly closed. |
| Usage: | An anti-inflammatory used as an analgesic. |
| Safety Data | |
 |
|
